CAS 1161940-88-0: Benzenepropanamine, 2-methoxy-5-methyl-N,N-bis(1-methylethyl)-γ-phenyl-, hydrochloride (1:1)

Description:Benzenepropanamine, 2-methoxy-5-methyl-N,N-bis(1-methylethyl)-γ-phenyl-, hydrochloride (1:1), identified by CAS number 1161940-88-0, is a chemical compound that belongs to the class of substituted amines. This compound features a complex structure characterized by a benzene ring, a propanamine backbone, and multiple substituents, including methoxy and isopropyl groups. The presence of the hydrochloride indicates that it is a salt form, which often enhances solubility in water and stability. The compound may exhibit biological activity due to its amine functionality, potentially interacting with various biological targets. Its specific properties, such as melting point, solubility, and reactivity, would depend on the molecular interactions of its substituents. As with many amines, it may also display basicity, allowing it to form salts with acids. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential pharmacological effects. Further studies would be necessary to elucidate its full chemical behavior and potential applications.

Formula:C₂₃H₃₃NO·ClH

InChI:InChI=1S/C23H33NO.ClH/c1-17(2)24(18(3)4)15-14-21(20-10-8-7-9-11-20)22-16-19(5)12-13-23(22)25-6;/h7-13,16-18,21H,14-15H2,1-6H3;1H

InChI key:InChIKey=RLCMDXVZQZSQIK-UHFFFAOYSA-N

SMILES:Cl.O(C1=CC=C(C=C1C(C=2C=CC=CC2)CCN(C(C)C)C(C)C)C)C