CAS 116195-81-4
:2,5-Diiodopyridine
Description:
2,5-Diiodopyridine is an organic compound characterized by the presence of two iodine atoms attached to a pyridine ring at the 2 and 5 positions. This compound has a molecular formula that reflects its halogenated structure, contributing to its unique chemical properties. It typically appears as a solid at room temperature and is soluble in organic solvents, which is common for halogenated aromatic compounds. The presence of iodine atoms enhances its reactivity, making it useful in various chemical synthesis applications, including the development of pharmaceuticals and agrochemicals. Additionally, 2,5-Diiodopyridine can participate in nucleophilic substitution reactions due to the electron-withdrawing nature of the iodine atoms, which can influence the electronic properties of the pyridine ring. Its derivatives may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Safety precautions should be taken when handling this compound, as iodine-containing substances can pose health risks and environmental concerns.
Formula:C5H3I2N
InChI:InChI=1/C5H3I2N/c6-4-1-2-5(7)8-3-4/h1-3H
SMILES:c1cc(I)ncc1I
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,5-Diiodopyridine
CAS:<p>2,5-Diiodopyridine is regiospecific and has been shown to have a high affinity for the nicotinic acetylcholine receptor. It has been synthesised by cross-coupling reactions of boronic acids with halides. 2,5-Diiodopyridine can also be used as a precursor for epibatidine. Epibatidine is a drug that binds to nicotinic acetylcholine receptors and activates them, which in turn leads to activation of voltage-gated calcium channels. This process leads to an increase in the release of dopamine, serotonin and norepinephrine from neurons. The uptake of 2,5-diiodopyridine was found at the level of 0.7% after 3 hours and 1% after 12 hours in mesoporous silica nanoparticles.<br>2,5-Diiodopyridine can be used as a precursor for epibatidine which is a drug that</p>Formula:C5H3I2NPurity:Min. 95 Area-%Color and Shape:PowderMolecular weight:330.89 g/mol
