CAS 116195-82-5
:2-(5-Bromo-2-pyridinyl)propanedinitrile
Description:
2-(5-Bromo-2-pyridinyl)propanedinitrile, with the CAS number 116195-82-5, is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a bromine atom and a propanedinitrile moiety. This compound typically appears as a solid and is known for its potential applications in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the bromine atom enhances its reactivity, making it a useful intermediate in various chemical reactions. Additionally, the nitrile groups contribute to its polar nature, influencing its solubility in organic solvents. The compound's properties, such as melting point, boiling point, and specific reactivity, can vary based on environmental conditions and the presence of other functional groups. Safety data indicates that, like many nitriles, it should be handled with care due to potential toxicity and environmental hazards. Overall, 2-(5-Bromo-2-pyridinyl)propanedinitrile is a valuable compound in the field of synthetic organic chemistry.
Formula:C8H4BrN3
InChI:InChI=1S/C8H4BrN3/c9-7-1-2-8(12-5-7)6(3-10)4-11/h1-2,5-6H
InChI key:InChIKey=VFTDUVQHWCLDTO-UHFFFAOYSA-N
SMILES:C(C#N)(C#N)C1=CC=C(Br)C=N1
Synonyms:- Propanedinitrile, 2-(5-bromo-2-pyridinyl)-
- 2-(5-Bromo-2-pyridinyl)propanedinitrile
- Propanedinitrile, (5-bromo-2-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
