CymitQuimica logo

CAS 116199-80-5

:

2,7-Dihydro-6-[[4-(2-hydroxyethyl)phenyl]amino]-3-methyl-2,7-dioxo-3H-naphtho[1,2,3-de]quinoline-1-carbonitrile

Description:
2,7-Dihydro-6-[[4-(2-hydroxyethyl)phenyl]amino]-3-methyl-2,7-dioxo-3H-naphtho[1,2,3-de]quinoline-1-carbonitrile, with CAS number 116199-80-5, is a synthetic organic compound characterized by its complex polycyclic structure, which includes a naphthoquinoline core. This compound features multiple functional groups, including a carbonitrile, an amine, and a hydroxyl group, contributing to its potential reactivity and solubility properties. It is likely to exhibit significant biological activity, making it of interest in pharmaceutical research, particularly in the development of therapeutic agents. The presence of the hydroxyl group may enhance its solubility in polar solvents, while the carbonitrile group can participate in various chemical reactions. Additionally, the compound's structure suggests potential interactions with biological targets, which could be explored in drug discovery. Overall, this compound's unique structural features and functional groups position it as a candidate for further investigation in medicinal chemistry and related fields.
Formula:C26H19N3O3
InChI:InChI=1S/C26H19N3O3/c1-29-21-11-10-20(28-16-8-6-15(7-9-16)12-13-30)23-24(21)22(19(14-27)26(29)32)17-4-2-3-5-18(17)25(23)31/h2-11,28,30H,12-13H2,1H3
InChI key:InChIKey=MYBHXFHNZVHDNM-UHFFFAOYSA-N
SMILES:C(#N)C1=C2C=3C(=C(NC4=CC=C(CCO)C=C4)C=CC3N(C)C1=O)C(=O)C=5C2=CC=CC5
Synonyms:
  • 2,7-Dihydro-6-[[4-(2-hydroxyethyl)phenyl]amino]-3-methyl-2,7-dioxo-3H-naphtho[1,2,3-de]quinoline-1-carbonitrile
  • 3H-Naphtho[1,2,3-de]quinoline-1-carbonitrile, 2,7-dihydro-6-[[4-(2-hydroxyethyl)phenyl]amino]-3-methyl-2,7-dioxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.