CAS 116200-98-7: 2-chloro-N-(1,3-thiazol-2-yl)propanamide
Description:2-Chloro-N-(1,3-thiazol-2-yl)propanamide is a chemical compound characterized by its unique structural features, which include a chloro substituent and a thiazole ring. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential reactivity due to the presence of the chloro group. The thiazole moiety contributes to its biological activity, often enhancing its interaction with biological targets. The presence of the chlorine atom can influence the compound's lipophilicity and reactivity, making it a candidate for various applications in medicinal chemistry and agrochemicals. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Overall, 2-chloro-N-(1,3-thiazol-2-yl)propanamide is of interest for its potential pharmacological properties and its role in synthetic organic chemistry.
Formula:C6H7ClN2OS
InChI:InChI=1/C6H7ClN2OS/c1-4(7)5(10)9-6-8-2-3-11-6/h2-4H,1H3,(H,8,9,10)
- Synonyms:
- Propanamide, 2-chloro-N-2-thiazolyl-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Propanamide, 2-chloro-N-2-thiazolyl- REF: IN-DA000BVJCAS: 116200-98-7 | - - - | To inquire | Tue 01 Apr 25 |
![]() | 2-Chloro-N-1,3-thiazol-2-ylpropanamide REF: 10-F038965CAS: 116200-98-7 | 95.0% | - - - | Discontinued product |
![]() | 2-Chloro-N-1,3-thiazol-2-ylpropanamide REF: 3D-FC121700CAS: 116200-98-7 | Min. 95% | - - - | Discontinued product |

2-Chloro-N-1,3-thiazol-2-ylpropanamide
Ref: 10-F038965
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
250mg | Discontinued | Request information |

2-Chloro-N-1,3-thiazol-2-ylpropanamide
Ref: 3D-FC121700
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |