CymitQuimica logo

CAS 116208-71-0

:

10-fluoro-2,3-dihydrobenzo[k]fluoranthene-2,3-diol

Description:
10-Fluoro-2,3-dihydrobenzo[k]fluoranthene-2,3-diol is a polycyclic aromatic hydrocarbon (PAH) derivative characterized by the presence of a fluorine atom and hydroxyl groups. This compound features a fused ring system typical of PAHs, which contributes to its stability and potential for various chemical interactions. The presence of the fluorine atom can enhance lipophilicity and influence the compound's reactivity, while the diol functional groups introduce sites for hydrogen bonding and potential reactivity in biological systems. Such compounds are often studied for their environmental persistence, potential toxicity, and role in biological processes. The specific arrangement of atoms and functional groups in this molecule may also affect its optical properties and interactions with other chemical species. As with many PAHs, understanding the behavior of this compound in different environments is crucial for assessing its environmental impact and potential health risks.
Formula:C20H13FO2
InChI:InChI=1/C20H13FO2/c21-12-5-4-10-7-15-13-2-1-3-14-19(13)17(9-18(22)20(14)23)16(15)8-11(10)6-12/h1-9,18,20,22-23H
Synonyms:
  • Benzo(k)fluoranthene-4,5-diol, 9-fluoro-4,5-dihydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.