CymitQuimica logo

CAS 116212-46-5

:

1,6-dihydro-6-methyl-7H-Pyrrolo[2,3-c]pyridin-7-one

Description:
1,6-Dihydro-6-methyl-7H-pyrrolo[2,3-c]pyridin-7-one is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings. This compound features a dihydro structure, indicating the presence of two hydrogen atoms that contribute to its saturation. The methyl group at the 6-position enhances its hydrophobic character and can influence its reactivity and solubility. The presence of the carbonyl group (ketone) at the 7-position is significant, as it can participate in various chemical reactions, including nucleophilic attacks and condensation reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its unique structure allows for potential interactions with biological targets, which could lead to therapeutic applications. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and solvent polarity. Overall, 1,6-dihydro-6-methyl-7H-pyrrolo[2,3-c]pyridin-7-one represents a versatile scaffold in organic synthesis and pharmaceutical research.
Formula:C8H8N2O
InChI:InChI=1S/C8H8N2O/c1-10-5-3-6-2-4-9-7(6)8(10)11/h2-5,9H,1H3
InChI key:ZLKWLYKVKAVOMD-UHFFFAOYSA-N
SMILES:CN1C=CC2=C(C1=O)NC=C2
Found 6 products.