
CAS 1162256-88-3
:1-Bromo-2-[(2,2-difluoroethyl)sulfinyl]benzene
Description:
1-Bromo-2-[(2,2-difluoroethyl)sulfinyl]benzene is an organic compound characterized by its aromatic structure, which includes a bromine atom and a sulfinyl group attached to a benzene ring. The presence of the sulfinyl group introduces a sulfur atom bonded to an oxygen atom, contributing to the compound's reactivity and potential applications in various chemical reactions. The difluoroethyl substituent enhances the compound's polarity and may influence its solubility and interaction with biological systems. This compound is likely to exhibit properties typical of halogenated aromatic compounds, such as increased stability and potential for electrophilic substitution reactions. Additionally, the presence of fluorine atoms can impart unique characteristics, including altered electronic properties and potential for use in medicinal chemistry. Overall, 1-Bromo-2-[(2,2-difluoroethyl)sulfinyl]benzene is a specialized compound that may find applications in pharmaceuticals, agrochemicals, or materials science, depending on its specific reactivity and interactions.
Formula:C8H7BrF2OS
InChI:InChI=1S/C8H7BrF2OS/c9-6-3-1-2-4-7(6)13(12)5-8(10)11/h1-4,8H,5H2
InChI key:InChIKey=SPSHPCFTGZQFEW-UHFFFAOYSA-N
SMILES:S(CC(F)F)(=O)C1=C(Br)C=CC=C1
Synonyms:- Benzene, 1-bromo-2-[(2,2-difluoroethyl)sulfinyl]-
- 1-Bromo-2-[(2,2-difluoroethyl)sulfinyl]benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.