
CAS 1162257-32-0
:B-[2-(2-Propen-1-yloxy)-5-(trifluoromethyl)phenyl]boronic acid
Description:
B-[2-(2-Propen-1-yloxy)-5-(trifluoromethyl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a phenyl ring substituted with a trifluoromethyl group, which enhances its electronic properties and lipophilicity. The presence of the propenyloxy group introduces a degree of reactivity, allowing for potential participation in cross-coupling reactions, such as Suzuki-Miyaura coupling, which is widely utilized in the formation of carbon-carbon bonds. Additionally, the trifluoromethyl group can impart unique characteristics such as increased metabolic stability and altered pharmacokinetics in drug development. Overall, this compound exemplifies the versatility of boronic acids in synthetic chemistry and their importance in the development of new materials and pharmaceuticals.
Formula:C10H10BF3O3
InChI:InChI=1S/C10H10BF3O3/c1-2-5-17-9-4-3-7(10(12,13)14)6-8(9)11(15)16/h2-4,6,15-16H,1,5H2
InChI key:InChIKey=KSGKGCRMAZFFRP-UHFFFAOYSA-N
SMILES:B(O)(O)C1=C(OCC=C)C=CC(C(F)(F)F)=C1
Synonyms:- Boronic acid, B-[2-(2-propen-1-yloxy)-5-(trifluoromethyl)phenyl]-
- B-[2-(2-Propen-1-yloxy)-5-(trifluoromethyl)phenyl]boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
B-[2-(2-Propen-1-yloxy)-5-(trifluoromethyl)phenyl]boronic acid
CAS:Formula:C10H10BF3O3Molecular weight:245.9908
