
CAS 1162257-39-7
:B-[4-(1-Fluoroethyl)phenyl]boronic acid
Description:
B-[4-(1-Fluoroethyl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a fluoroethyl group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the fluoroethyl group can enhance lipophilicity and influence the compound's reactivity and biological activity. Additionally, boronic acids are known for their role in Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds in organic synthesis. The compound's structure suggests potential applications in drug development, particularly in the design of inhibitors or modulators of biological targets. Its stability, solubility, and reactivity can vary based on the specific conditions and solvents used in experiments. Overall, B-[4-(1-Fluoroethyl)phenyl]boronic acid represents a versatile building block in modern organic chemistry.
Formula:C8H10BFO2
InChI:InChI=1S/C8H10BFO2/c1-6(10)7-2-4-8(5-3-7)9(11)12/h2-6,11-12H,1H3
InChI key:InChIKey=CCGJNDCCSQEAMT-UHFFFAOYSA-N
SMILES:B(O)(O)C1=CC=C(C(C)F)C=C1
Synonyms:- Boronic acid, B-[4-(1-fluoroethyl)phenyl]-
- B-[4-(1-Fluoroethyl)phenyl]boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.