
CAS 1162262-03-4
:1-(1-Azetidinyl)-2-(methylsulfonyl)ethanone
Description:
1-(1-Azetidinyl)-2-(methylsulfonyl)ethanone, identified by its CAS number 1162262-03-4, is a chemical compound characterized by the presence of an azetidine ring, which is a four-membered saturated heterocyclic structure containing one nitrogen atom. This compound features a methylsulfonyl group, which contributes to its polar nature and potential reactivity. The ethanone moiety indicates the presence of a ketone functional group, suggesting that it may participate in various chemical reactions typical of carbonyl compounds, such as nucleophilic addition. The azetidine ring can influence the compound's biological activity and pharmacological properties, making it of interest in medicinal chemistry. Its unique structure may also impart specific physical properties, such as solubility and stability, which are crucial for its application in research or industry. Overall, this compound's characteristics make it a subject of interest for further studies, particularly in the fields of organic synthesis and drug development.
Formula:C6H11NO3S
InChI:InChI=1S/C6H11NO3S/c1-11(9,10)5-6(8)7-3-2-4-7/h2-5H2,1H3
InChI key:InChIKey=HUAHKSXJGCDNCR-UHFFFAOYSA-N
SMILES:C(CS(C)(=O)=O)(=O)N1CCC1
Synonyms:- Ethanone, 1-(1-azetidinyl)-2-(methylsulfonyl)-
- 1-(1-Azetidinyl)-2-(methylsulfonyl)ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.