
CAS 1162262-05-6
:5-Bromo-N2-cyclopropyl-4-methyl-2,3-pyridinediamine
Description:
5-Bromo-N2-cyclopropyl-4-methyl-2,3-pyridinediamine is a chemical compound characterized by its unique structure, which includes a bromine atom, a cyclopropyl group, and two amine functional groups attached to a pyridine ring. This compound is part of the pyridine family, which is known for its aromatic properties and nitrogen-containing heterocycles. The presence of the bromine substituent can influence the compound's reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The cyclopropyl group may contribute to the compound's steric properties, potentially affecting its biological activity and interaction with target proteins. Additionally, the amine groups can participate in hydrogen bonding, which is crucial for solubility and binding interactions in biological systems. Overall, 5-Bromo-N2-cyclopropyl-4-methyl-2,3-pyridinediamine exhibits characteristics that make it of interest in various chemical and pharmaceutical research contexts.
Formula:C9H12BrN3
InChI:InChI=1S/C9H12BrN3/c1-5-7(10)4-12-9(8(5)11)13-6-2-3-6/h4,6H,2-3,11H2,1H3,(H,12,13)
InChI key:InChIKey=SPVVOLHZPJKQSB-UHFFFAOYSA-N
SMILES:N(C1=C(N)C(C)=C(Br)C=N1)C2CC2
Synonyms:- 2,3-Pyridinediamine, 5-bromo-N2-cyclopropyl-4-methyl-
- 5-Bromo-N2-cyclopropyl-4-methyl-2,3-pyridinediamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.