CAS 116228-41-2

4-Bromo-1-[(4-methylphenyl)sulfonyl]-1H-pyrazole

Description:

4-Bromo-1-[(4-methylphenyl)sulfonyl]-1H-pyrazole, with the CAS number 116228-41-2, is a chemical compound characterized by its pyrazole core, which is a five-membered heterocyclic structure containing two adjacent nitrogen atoms. The presence of a bromine atom at the 4-position of the pyrazole ring contributes to its reactivity and potential applications in various chemical reactions. Additionally, the sulfonyl group attached to a para-methylphenyl moiety enhances its solubility and stability, making it suitable for use in organic synthesis and medicinal chemistry. This compound may exhibit biological activity, potentially serving as a lead compound in drug development, particularly in areas such as anti-inflammatory or anticancer research. Its molecular structure suggests that it could participate in various interactions, including hydrogen bonding and π-π stacking, which are important in biological systems. Overall, 4-Bromo-1-[(4-methylphenyl)sulfonyl]-1H-pyrazole is a versatile compound with significant implications in both synthetic and medicinal chemistry.

Formula: C₁₀H₉BrN₂O₂S

InChI: InChI=1S/C10H9BrN2O2S/c1-8-2-4-10(5-3-8)16(14,15)13-7-9(11)6-12-13/h2-7H,1H3

InChI key: InChIKey=XRKOINRPMVFMFN-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1=CC=C(C)C=C1)N2C=C(Br)C=N2

Synonyms:

• 4-Bromo-1-[(4-methylphenyl)sulfonyl]-1H-pyrazole
• 1H-Pyrazole, 4-bromo-1-[(4-methylphenyl)sulfonyl]-
• 4-Bromo-1-tosyl-1H-pyrazole

1H-Pyrazole, 4-bromo-1-[(4-methylphenyl)sulfonyl]-

CAS: 116228-41-2

Formula: C₁₀H₉BrN₂O₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 301.1597

Ref: IN-DA000BZ9

4-Bromo-1-tosyl-1H-pyrazole

CAS: 116228-41-2

4-Bromo-1-tosyl-1H-pyrazole

Purity: 98%

Molecular weight: 301.16g/mol

Ref: 54-OR90053

4-Bromo-1-tosyl-1H-pyrazole

CAS: 116228-41-2

Formula: C₁₀H₉BrN₂O₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 301.16

Ref: 10-F458205