
CAS 116229-37-9
:1-Butanol, 2-mercapto-3-methyl-
Description:
1-Butanol, 2-mercapto-3-methyl- is an organic compound characterized by the presence of both a hydroxyl group (-OH) and a thiol group (-SH) in its structure. This compound features a four-carbon straight-chain alcohol with a methyl group and a mercapto group attached to the second and third carbon atoms, respectively. Its molecular structure contributes to its unique properties, including moderate solubility in water due to the hydroxyl group, while the thiol group imparts distinctive odor characteristics often associated with sulfur compounds. The presence of these functional groups suggests that the compound may exhibit reactivity typical of alcohols and thiols, such as participating in oxidation-reduction reactions. Additionally, 1-butanol derivatives are often used in various applications, including solvents, chemical intermediates, and in the synthesis of other organic compounds. Safety considerations should be taken into account, as thiols can be malodorous and potentially toxic. Overall, this compound exemplifies the diverse chemistry of alcohols and thiols in organic synthesis and industrial applications.
Formula:C5H12OS
InChI:InChI=1S/C5H12OS/c1-4(2)5(7)3-6/h4-7H,3H2,1-2H3
InChI key:InChIKey=QBYYSQQYPUMFOX-UHFFFAOYSA-N
SMILES:C(C(C)C)(CO)S
Synonyms:- 1-Butanol, 2-mercapto-3-methyl-
- 3-Methyl-2-sulfanylbutan-1-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
