CymitQuimica logo

CAS 116229-44-8

:

4-[[3-(Triethoxysilyl)propyl]imino]-2-pentanone

Description:
4-[[3-(Triethoxysilyl)propyl]imino]-2-pentanone, with the CAS number 116229-44-8, is a chemical compound that features a silane functional group, which is characterized by the presence of triethoxysilyl groups. This compound typically exhibits properties associated with both organic and inorganic chemistry due to its silane structure. It is likely to be a colorless to pale yellow liquid or solid, depending on its specific formulation and purity. The presence of the imino group suggests potential reactivity, particularly in condensation reactions, which can lead to the formation of various derivatives. Additionally, the triethoxysilyl moiety enhances its compatibility with silicate materials, making it useful in applications such as surface modification, adhesion promotion, and as a coupling agent in composite materials. The compound may also exhibit hydrophobic characteristics due to the ethoxy groups, influencing its solubility in various solvents. Overall, its unique structure allows for diverse applications in materials science and surface chemistry.
Formula:C14H29NO4Si
InChI:InChI=1S/C14H29NO4Si/c1-6-17-20(18-7-2,19-8-3)11-9-10-15-13(4)12-14(5)16/h6-12H2,1-5H3
InChI key:InChIKey=HDLSYFGPMIZPTI-UHFFFAOYSA-N
SMILES:[Si](CCCN=C(CC(C)=O)C)(OCC)(OCC)OCC
Synonyms:
  • 2-Pentanone, 4-[[3-(triethoxysilyl)propyl]imino]-
  • 4-[[3-(Triethoxysilyl)propyl]imino]-2-pentanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.