CAS 116230-30-9

2-Bromo-7-hydroxynaphthalene

Description:

2-Bromo-7-hydroxynaphthalene is an organic compound characterized by the presence of a bromine atom and a hydroxyl group attached to a naphthalene ring system. This compound features a naphthalene backbone, which consists of two fused benzene rings, providing it with a planar structure and significant aromatic character. The bromine substituent at the second position and the hydroxyl group at the seventh position influence its chemical reactivity and solubility properties. Typically, compounds like 2-Bromo-7-hydroxynaphthalene exhibit moderate to high lipophilicity due to the hydrophobic nature of the naphthalene structure, while the hydroxyl group can engage in hydrogen bonding, enhancing solubility in polar solvents. This compound may also participate in various chemical reactions, such as nucleophilic substitution or electrophilic aromatic substitution, due to the presence of the bromine atom. Additionally, it may have applications in organic synthesis and materials science, particularly in the development of dyes, pharmaceuticals, or as intermediates in chemical reactions.

Formula: C₁₀H₇BrO

InChI: InChI=1/C10H7BrO/c11-9-3-1-7-2-4-10(12)6-8(7)5-9/h1-6,12H

SMILES: c1cc(cc2cc(ccc12)O)Br

Synonyms:

• 7-Bromonaphthalen-2-OL
• 7-Bromonaphthalene-2-ol

7-Bromo-2-naphthol

CAS: 116230-30-9

Formula: C₁₀H₇BrO

Purity: >97.0%(GC)

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 223.07

Ref: 3B-B4580

2-Naphthalenol, 7-bromo-

CAS: 116230-30-9

Formula: C₁₀H₇BrO

Purity: 97%

Color and Shape: Solid

Molecular weight: 223.0660

Ref: IN-DA000C02

7-Bromonaphthalen-2-ol

CAS: 116230-30-9

7-Bromonaphthalen-2-ol

Formula: C₁₀H₇BrO

Purity: ≥95%

Color and Shape: off white crystalline solid

Molecular weight: 223.07g/mol

Ref: 54-OR301112

2-Bromo-7-hydroxynaphthalene

CAS: 116230-30-9

Formula: C₁₀H₇BrO

Purity: 97%

Color and Shape: Solid, Crystalline Powder

Molecular weight: 223.069

Ref: 10-F049932