CAS 116248-10-3
:2-(4-Fluorophenyl)-5-benzoxazolamine
Description:
2-(4-Fluorophenyl)-5-benzoxazolamine, with the CAS number 116248-10-3, is a chemical compound characterized by its unique structure, which includes a benzoxazole ring and a fluorophenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for various chemical reactions. The presence of the fluorine atom can influence its reactivity and solubility, often enhancing lipophilicity and biological activity. It may also exhibit fluorescence due to the benzoxazole moiety, making it useful in applications such as fluorescent probes or dyes. Additionally, compounds of this nature may have implications in medicinal chemistry, potentially serving as intermediates or active pharmaceutical ingredients due to their ability to interact with biological targets. The specific characteristics, such as melting point, boiling point, and solubility, would depend on the compound's purity and the conditions under which it is measured. Overall, 2-(4-Fluorophenyl)-5-benzoxazolamine represents a versatile structure with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C13H9FN2O
InChI:InChI=1S/C13H9FN2O/c14-9-3-1-8(2-4-9)13-16-11-7-10(15)5-6-12(11)17-13/h1-7H,15H2
InChI key:InChIKey=OHKSDBATRIWCTK-UHFFFAOYSA-N
SMILES:FC1=CC=C(C=2OC=3C(N2)=CC(N)=CC3)C=C1
Synonyms:- 2-(4-Fluoro-phenyl)-benzooxazol-5-ylamine
- 5-Benzoxazolamine, 2-(4-fluorophenyl)-
- 2-(4-Fluorophenyl)-1,3-benzoxazol-5-amine
- 2-(4-Fluorophenyl)-5-benzoxazolamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-(4-Fluoro-phenyl)-benzooxazol-5-ylamine
CAS:Color and Shape:SolidMolecular weight:228.2259979248047

