
CAS 116249-66-2
:Benanomicin B
Description:
Benanomicin B is a naturally occurring compound classified as a macrolide antibiotic. It is derived from the fermentation of certain Streptomyces species. This compound exhibits a complex structure characterized by a large lactone ring, which is typical of macrolides, and contains multiple functional groups that contribute to its biological activity. Benanomicin B is known for its antibacterial properties, particularly against Gram-positive bacteria, making it of interest in pharmaceutical research. Its mechanism of action involves inhibition of protein synthesis, similar to other antibiotics in its class. Additionally, Benanomicin B has shown potential in the treatment of various infections, although its clinical use may be limited due to factors such as toxicity and resistance. The compound's solubility, stability, and pharmacokinetic properties are important considerations in its development as a therapeutic agent. Overall, Benanomicin B represents a significant example of the diverse chemical structures found in natural products with potential medicinal applications.
Formula:C39H42N2O18
InChI:InChI=1S/C39H42N2O18/c1-10-5-17-23(30(48)20(10)36(52)41-11(2)37(53)54)22-15(8-16-24(31(22)49)27(45)14-6-13(55-4)7-18(42)21(14)26(16)44)28(46)34(17)58-39-33(51)35(25(40)12(3)57-39)59-38-32(50)29(47)19(43)9-56-38/h5-8,11-12,19,25,28-29,32-35,38-39,42-43,46-51H,9,40H2,1-4H3,(H,41,52)(H,53,54)/t11-,12-,19-,25+,28+,29+,32-,33-,34+,35+,38+,39+/m1/s1
InChI key:InChIKey=IHIIRQILYAXIOH-NUVDETJMSA-N
SMILES:OC1=C2C=3C(=CC4=C(C3O)C(=O)C=5C(C4=O)=C(O)C=C(OC)C5)[C@H](O)[C@@H](O[C@H]6[C@H](O)[C@@H](O[C@H]7[C@H](O)[C@@H](O)[C@H](O)CO7)[C@@H](N)[C@@H](C)O6)C2=CC(C)=C1C(N[C@@H](C(O)=O)C)=O
Synonyms:- Benanomicin B
- N-[[(5S,6S)-5-[(4-Amino-4,6-dideoxy-3-O-β-D-xylopyranosyl-β-D-galactopyranosyl)oxy]-5,6,8,13-tetrahydro-1,6,9,14-tetrahydroxy-11-methoxy-3-methyl-8,13-dioxobenzo[a]naphthacen-2-yl]carbonyl]-D-alanine
- D-Alanine, N-[[5-[(4-amino-4,6-dideoxy-3-O-β-D-xylopyranosyl-β-D-galactopyranosyl)oxy]-5,6,8,13-tetrahydro-1,6,9,14-tetrahydroxy-11-methoxy-3-methyl-8,13-dioxobenzo[a]naphthacen-2-yl]carbonyl]-, (5S-trans)-
- Benzo[a]naphthacene, D-alanine deriv.
- D-Alanine, N-[[(5S,6S)-5-[(4-amino-4,6-dideoxy-3-O-β-D-xylopyranosyl-β-D-galactopyranosyl)oxy]-5,6,8,13-tetrahydro-1,6,9,14-tetrahydroxy-11-methoxy-3-methyl-8,13-dioxobenzo[a]naphthacen-2-yl]carbonyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benanomicin B
CAS:The compound exhibits excellent antifungal and antiviral activities, including against HIV.Formula:C39H42N2O18Color and Shape:SolidMolecular weight:826.75
