
CAS 116249-88-8
:Methyl 2-(2,6-dimethoxyphenoxy)acetate
Description:
Methyl 2-(2,6-dimethoxyphenoxy)acetate, with the CAS number 116249-88-8, is an organic compound characterized by its ester functional group. It features a methyl ester derived from the acetylation of a phenolic compound, specifically one that contains two methoxy groups at the 2 and 6 positions of the aromatic ring. This structure contributes to its chemical properties, including moderate polarity due to the presence of the methoxy groups, which can influence solubility in various solvents. The compound is likely to exhibit typical ester reactivity, such as hydrolysis under acidic or basic conditions, and may participate in nucleophilic substitution reactions. Its aromatic nature suggests potential applications in organic synthesis and as a building block in the development of pharmaceuticals or agrochemicals. Additionally, the presence of methoxy groups can enhance its biological activity and influence its interaction with biological systems. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper usage in laboratory or industrial settings.
Formula:C11H14O5
InChI:InChI=1S/C11H14O5/c1-13-8-5-4-6-9(14-2)11(8)16-7-10(12)15-3/h4-6H,7H2,1-3H3
InChI key:InChIKey=DGMVTVCDPVFADE-UHFFFAOYSA-N
SMILES:O(CC(OC)=O)C1=C(OC)C=CC=C1OC
Synonyms:- Acetic acid, 2-(2,6-dimethoxyphenoxy)-, methyl ester
- Acetic acid, (2,6-dimethoxyphenoxy)-, methyl ester
- Methyl 2-(2,6-dimethoxyphenoxy)acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
