
CAS 116267-92-6
:Benzenamine, 2-ethyl-, homopolymer
Description:
Benzenamine, 2-ethyl-, homopolymer, also known as poly(2-ethyl aniline), is a polymer derived from the polymerization of 2-ethyl aniline, an aromatic amine. This substance exhibits characteristics typical of conducting polymers, including electrical conductivity, which can be influenced by its degree of polymerization and the presence of dopants. The polymer is generally characterized by its stability, solubility in organic solvents, and ability to form films. Its structure features a backbone of aromatic rings, which contributes to its mechanical strength and thermal stability. Additionally, the presence of amine groups allows for potential interactions with various chemical species, making it useful in applications such as sensors, coatings, and electronic devices. The polymer's properties can be tailored through modifications in synthesis conditions, such as temperature and solvent choice, which can affect its molecular weight and conductivity. Safety considerations should be taken into account due to the potential toxicity of its monomeric form and the need for proper handling and disposal methods.
Formula:(C8H11N)x
InChI:InChI=1S/C8H11N/c1-2-7-5-3-4-6-8(7)9/h3-6H,2,9H2,1H3
InChI key:InChIKey=MLPVBIWIRCKMJV-UHFFFAOYSA-N
SMILES:C(C)C1=C(N)C=CC=C1
Synonyms:- Poly(o-ethylaniline)
- o-Ethylaniline homopolymer
- o-Ethylaniline polymer
- Benzenamine, 2-ethyl-, homopolymer
- Poly(2-ethylaniline)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
