
CAS 116267-93-7
:[1,1′-Biphenyl]-4-amine, homopolymer
Description:
[1,1′-Biphenyl]-4-amine, homopolymer, identified by CAS number 116267-93-7, is a synthetic polymer characterized by its structural composition derived from biphenyl and amine functional groups. This polymer typically exhibits high thermal stability and good mechanical properties, making it suitable for various applications in materials science and engineering. Its chemical structure allows for potential interactions with other materials, enhancing its utility in composite formulations. The presence of amine groups can facilitate hydrogen bonding, contributing to the polymer's strength and durability. Additionally, this substance may demonstrate interesting electrical properties, which can be advantageous in electronic applications. The polymer's solubility and processing characteristics can vary based on its molecular weight and degree of polymerization, influencing its application in coatings, adhesives, and other industrial products. Overall, [1,1′-Biphenyl]-4-amine, homopolymer is a versatile material with potential uses in advanced technologies, particularly where thermal and mechanical resilience is required.
Formula:(C12H11N)x
InChI:InChI=1S/C12H11N/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H,13H2
InChI key:InChIKey=DMVOXQPQNTYEKQ-UHFFFAOYSA-N
SMILES:NC1=CC=C(C=C1)C2=CC=CC=C2
Synonyms:- [1,1′-Biphenyl]-4-amine, homopolymer
- Poly(4-aminobiphenyl)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
