CAS 116270-39-4
:1-Acetyl-5-bromo-4-chloro-1,2-dihydro-3H-indol-3-one
Description:
1-Acetyl-5-bromo-4-chloro-1,2-dihydro-3H-indol-3-one is a chemical compound that belongs to the indole family, characterized by its bicyclic structure containing a fused benzene and pyrrole ring. This compound features several functional groups, including an acetyl group, a bromo substituent, and a chloro substituent, which contribute to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of halogens (bromine and chlorine) can enhance the compound's biological activity and influence its interaction with various biological targets. The indole framework is known for its significance in pharmaceuticals, as many indole derivatives exhibit a range of biological activities, including anti-inflammatory, anticancer, and antimicrobial properties. The compound's molecular structure suggests it may participate in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions, making it a valuable intermediate in the synthesis of more complex molecules. Overall, 1-Acetyl-5-bromo-4-chloro-1,2-dihydro-3H-indol-3-one is of interest for further research in both synthetic and medicinal chemistry.
Formula:C10H7BrClNO2
InChI:InChI=1S/C10H7BrClNO2/c1-5(14)13-4-8(15)9-7(13)3-2-6(11)10(9)12/h2-3H,4H2,1H3
InChI key:InChIKey=ACRKWYSLKIICNW-UHFFFAOYSA-N
SMILES:C(C)(=O)N1C=2C(C(=O)C1)=C(Cl)C(Br)=CC2
Synonyms:- Pseudoindoxyl, 1-acetyl-5-bromo-4-chloro-
- 3H-Indol-3-one, 1-acetyl-5-bromo-4-chloro-1,2-dihydro-
- 1-Acetyl-5-bromo-4-chloroindolin-3-one
- 1-Acetyl-5-bromo-4-chloro-1,2-dihydro-3H-indol-3-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Acetyl-5-bromo-4-chloro-pseudoindoxyl
CAS:Formula:C10H7BrClNO2Color and Shape:SolidMolecular weight:288.5251
