
CAS 116286-87-4
:3,4-Dihydro-4-oxo-1-phthalazinecarboxaldehyde
Description:
3,4-Dihydro-4-oxo-1-phthalazinecarboxaldehyde, with the CAS number 116286-87-4, is a chemical compound characterized by its unique phthalazine structure, which consists of a bicyclic system containing a hydrazine moiety. This compound features a carbonyl group (ketone) and an aldehyde functional group, contributing to its reactivity and potential applications in organic synthesis. It is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. The presence of the aldehyde group suggests that it can participate in various chemical reactions, such as condensation and oxidation, making it a valuable intermediate in the synthesis of more complex molecules. Additionally, compounds with similar structures have been studied for their biological activities, including potential pharmaceutical applications. However, specific safety and handling information should be consulted, as with any chemical substance, to ensure proper laboratory practices. Overall, 3,4-Dihydro-4-oxo-1-phthalazinecarboxaldehyde is an interesting compound with diverse chemical properties and potential utility in research and industry.
Formula:C9H6N2O2
InChI:InChI=1S/C9H6N2O2/c12-5-8-6-3-1-2-4-7(6)9(13)11-10-8/h1-5H,(H,11,13)
InChI key:InChIKey=PBJJLZYNPLMYDZ-UHFFFAOYSA-N
SMILES:C(=O)C=1C=2C(C(=O)NN1)=CC=CC2
Synonyms:- 1-Phthalazinecarboxaldehyde, 3,4-dihydro-4-oxo-
- 3,4-Dihydro-4-oxo-1-phthalazinecarboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.