CAS 116287-19-5
:1-Propanamine, 2,3,3-trichloro-N,N-dimethyl-
Description:
1-Propanamine, 2,3,3-trichloro-N,N-dimethyl- is an organic compound characterized by its amine functional group and the presence of multiple chlorine substituents on the propanamine backbone. This compound features a propanamine structure with a dimethyl substitution on the nitrogen atom, which contributes to its basicity and potential reactivity. The presence of three chlorine atoms introduces significant electronegativity, influencing the compound's physical and chemical properties, such as increased polarity and potential for hydrogen bonding. It is likely to be a colorless to pale yellow liquid or solid, depending on its specific form and purity. The compound may exhibit moderate to high toxicity, necessitating careful handling and storage. Its applications could range from use in chemical synthesis to potential roles in pharmaceuticals or agrochemicals, although specific uses would depend on further research and regulatory assessments. As with many chlorinated compounds, environmental persistence and bioaccumulation are important considerations in its evaluation.
Formula:C5H10Cl3N
InChI:InChI=1S/C5H10Cl3N/c1-9(2)3-4(6)5(7)8/h4-5H,3H2,1-2H3
InChI key:InChIKey=TURIUCQLFFTWOW-UHFFFAOYSA-N
SMILES:C(CN(C)C)(C(Cl)Cl)Cl
Synonyms:- 2,3,3-Trichloro-N,N-dimethylpropan-1-amine
- 1-Propanamine, 2,3,3-trichloro-N,N-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
