CAS 116292-10-5
:Norleucine,5-amino-6-fluoro-(9CI)
Description:
Norleucine, 5-amino-6-fluoro- (9CI) is an amino acid derivative characterized by the presence of a fluorine atom at the 6-position of the norleucine structure. It features a basic amino group (-NH2) and a carboxylic acid group (-COOH), typical of amino acids, which allows it to participate in peptide bond formation. The fluorine substitution can influence its biochemical properties, potentially affecting its polarity, solubility, and interaction with biological targets. This compound is often utilized in research settings, particularly in studies related to peptide synthesis and the development of pharmaceuticals. Its unique structural attributes may also make it a candidate for exploring the effects of fluorinated amino acids in protein structure and function. As with many fluorinated compounds, it may exhibit altered metabolic pathways compared to its non-fluorinated counterparts. Safety and handling precautions should be observed due to its chemical nature, and it is essential to refer to specific safety data sheets for detailed information.
Formula:C6H13FN2O2
InChI:InChI=1/C6H13FN2O2/c7-3-4(8)1-2-5(9)6(10)11/h4-5H,1-3,8-9H2,(H,10,11)
SMILES:C(CC(C(=O)O)N)C(CF)N
Synonyms:- 5-Fluoromethylornithine
- 5-Amino-6-Fluoronorleucine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.