CAS 116296-31-2

2-(Undecylthio)acetic acid

Description:

2-(Undecylthio)acetic acid is an organic compound characterized by its long hydrocarbon chain and functional groups. It features a thioether group, which contributes to its unique properties, including increased hydrophobicity due to the undecyl chain. The presence of the acetic acid moiety provides acidic characteristics, allowing it to participate in various chemical reactions, such as esterification and amidation. This compound is likely to be a viscous liquid at room temperature, with a relatively high boiling point due to the length of the undecyl chain. Its solubility profile suggests limited solubility in water but better solubility in organic solvents, making it useful in various applications, including surfactants, emulsifiers, or as a building block in organic synthesis. Additionally, the thioether functionality may impart specific reactivity, making it valuable in medicinal chemistry and materials science. Overall, 2-(Undecylthio)acetic acid exhibits a combination of hydrophobic and polar characteristics, which can be exploited in diverse chemical applications.

Formula: C₁₃H₂₆O₂S

InChI: InChI=1S/C13H26O2S/c1-2-3-4-5-6-7-8-9-10-11-16-12-13(14)15/h2-12H2,1H3,(H,14,15)

InChI key: InChIKey=CZSSKBQAJULWPY-UHFFFAOYSA-N

SMILES: C(CCCCCCCC)CCSCC(O)=O

Synonyms:

• Acetic acid, (undecylthio)-
• 3-Thiatetradecanoic acid
• 2-(Undecylthio)acetic acid
• Acetic acid, 2-(undecylthio)-

Acetic acid, 2-(undecylthio)-

CAS: 116296-31-2

Formula: C₁₃H₂₆O₂S

Molecular weight: 246.4093

Ref: IN-DA000C4F