CAS 116297-12-2

(S)-N-(2-Propyl)-1-phenylethylamine hydrochloride

Description:

(S)-N-(2-Propyl)-1-phenylethylamine hydrochloride, with the CAS number 116297-12-2, is a chiral amine characterized by its specific stereochemistry, which is crucial for its biological activity. This compound features a phenylethylamine backbone, with a propyl group attached to the nitrogen atom, contributing to its hydrophobic properties. The hydrochloride salt form enhances its solubility in water, making it more suitable for various applications, including pharmaceutical formulations. As a chiral molecule, it may exhibit different pharmacological effects depending on its stereoisomerism, which is significant in drug development. The presence of the amine functional group allows for potential interactions with biological receptors, influencing its efficacy and safety profile. Additionally, the compound's structural features suggest it may participate in hydrogen bonding and other intermolecular interactions, which can affect its behavior in biological systems. Overall, (S)-N-(2-Propyl)-1-phenylethylamine hydrochloride is of interest in medicinal chemistry, particularly in the context of developing therapeutics that target specific biological pathways.

Formula: C₁₁H₁₈ClN

InChI: InChI=1/C11H17N.ClH/c1-9(2)12-10(3)11-7-5-4-6-8-11;/h4-10,12H,1-3H3;1H/t10-;/m0./s1

SMILES: CC(C)N[C@@H](C)c1ccccc1.Cl

Synonyms:

• (S)-N-Isopropyl-1-phenylethylamine hydrochloride
• N-[(1S)-1-phenylethyl]propan-2-amine hydrochloride

(S)-(-)-N-Isopropyl-1-phenylethylamine hydrochloride

CAS: 116297-12-2

Formula: C₁₁H₁₈ClN

Color and Shape: Solid

Molecular weight: 199.7203

Ref: IN-DA000C5H