CAS 116303-65-2
:sarafotoxin S6B
Description:
Sarafotoxin S6B is a potent neurotoxin derived from the venom of the African snake, specifically the mamba species. It belongs to a class of peptides known as sarafotoxins, which are structurally similar to endothelins, a group of peptides that play a role in vasoconstriction and blood pressure regulation. Sarafotoxin S6B exhibits high affinity for endothelin receptors, particularly the ET-1 receptor, leading to significant physiological effects such as vasoconstriction and increased blood pressure. The peptide is characterized by its relatively small size and specific amino acid sequence, which contributes to its biological activity. Due to its potent effects on the cardiovascular system, sarafotoxin S6B is of interest in pharmacological research, particularly in studies related to hypertension and cardiovascular diseases. Additionally, its mechanism of action and receptor interactions make it a valuable tool for understanding the role of endothelin in various physiological processes. However, due to its toxic nature, handling and research involving sarafotoxin S6B require strict safety protocols.
Formula:C110H159N27O34S5
InChI:InChI=1/C110H162N26O35S5/c1-9-55(6)88(108(168)134-87(54(4)5)107(167)129-77(110(170)171)40-59-45-115-64-22-14-13-21-62(59)64)135-102(162)76(44-86(148)149)127-93(153)67(29-31-82(140)141)120-99(159)73(41-60-46-114-52-116-60)125-106(166)81(51-175)132-98(158)71(38-57-19-11-10-12-20-57)124-97(157)72(39-58-25-27-61(139)28-26-58)123-96(156)70(37-53(2)3)122-105(165)80(50-174)131-94(154)68(30-32-83(142)143)119-91(151)65(23-15-17-34-111)117-101(161)75(43-85(146)147)128-109(169)89(56(7)138)136-95(155)69(33-36-176-8)121-100(160)74(42-84(144)145)126-92(152)66(24-16-18-35-112)118-104(164)79(49-173)133-103(163)78(47-137)130-90(150)63(113)48-172/h10-14,19-22,25-28,45-46,52-56,63,65-81,87-89,115,137-139,172-175H,9,15-18,23-24,29-44,47-51,111-113H2,1-8H3,(H,114,116)(H,117,161)(H,118,164)(H,119,151)(H,120,159)(H,121,160)(H,122,165)(H,123,156)(H,124,157)(H,125,166)(H,126,152)(H,127,153)(H,128,169)(H,129,167)(H,130,150)(H,131,154)(H,132,158)(H,133,163)(H,134,168)(H,135,162)(H,136,155)(H,140,141)(H,142,143)(H,144,145)(H,146,147)(H,148,149)(H,170,171)/t55-,56+,63-,65-,66-,67-,68-,69-,70-,71-,72-,73-,74-,75-,76-,77-,78-,79-,80-,81-,87-,88-,89-/m0/s1
Synonyms:- Sarafotoxin B
- H-Cys-Ser-Cys-Lys-Asp-Met-Thr-Asp-Lys-Glu-Cys-Leu-Tyr-Phe-Cys-His-Gln-Asp-Val-Ile-Trp-Oh-Oh
- H-Cys-Ser-Cys-Lys-Asp-Met-Thr-Asp-Lys-Glu-Cys-Leu-Tyr-Phe-Cys-His-Gln-Asp-Val-Ile-Trp-Oh
- Csckdmtdkeclyfchqdviw
- Sarafotoxin S6B Atractaspis Engaddensis Sequence
- Cys-Ser-Cys-Lys-Asp-Met-Thr-Asp-Lys-Glu-Cys-Leu-Tyr-Phe-Cys-His-Gln-Asp-Val-Ile-Trp
- Sarafotoxin S6B (Atractaspis Engaddensis)
- Sarafotoxin S6b, Atractaspsisengaddensis
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Sarafotoxin S6b
CAS:non-selective endothelin receptor agonistFormula:C110H163N27O34S5Purity:98%Color and Shape:SolidMolecular weight:2567.96
