CAS 116308-56-6: 2-{4-[4-(diphenylmethyl)piperazin-1-yl]phenyl}ethyl methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate hydrochloride
Description:The chemical substance known as 2-{4-[4-(diphenylmethyl)piperazin-1-yl]phenyl}ethyl methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate hydrochloride, with the CAS number 116308-56-6, is a complex organic compound that belongs to the class of dihydropyridine derivatives. This compound features a dihydropyridine core, which is characterized by its ability to act as a calcium channel blocker, making it of interest in pharmacological applications. The presence of multiple functional groups, including piperazine and nitrophenyl moieties, suggests potential interactions with biological targets, contributing to its pharmacological profile. The hydrochloride salt form indicates enhanced solubility in aqueous environments, which is beneficial for drug formulation. Additionally, the compound's structural complexity may influence its biological activity, selectivity, and overall efficacy. As with many synthetic organic compounds, understanding its stability, reactivity, and potential side effects is crucial for its application in medicinal chemistry and therapeutic development.
Formula:C41H43ClN4O6
InChI:InChI=1/C41H42N4O6.ClH/c1-28-36(40(46)50-3)38(33-15-10-16-35(27-33)45(48)49)37(29(2)42-28)41(47)51-26-21-30-17-19-34(20-18-30)43-22-24-44(25-23-43)39(31-11-6-4-7-12-31)32-13-8-5-9-14-32;/h4-20,27,38-39,42H,21-26H2,1-3H3;1H
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | AE0047 Hydrochloride REF: TM-T13328CAS: 116308-56-6 | 98% | 905.00 €~2,375.00 € | Tue 22 Apr 25 |
![]() | Watanipidine monohydrochloride REF: 3D-REA30856CAS: 116308-56-6 | Min. 95% | - - - | Discontinued product |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
AE0047 Hydrochloride
Ref: TM-T13328
25mg | 1,444.00 € | ||
50mg | 1,882.00 € | ||
100mg | 2,375.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Watanipidine monohydrochloride
Ref: 3D-REA30856
1mg | Discontinued | Request information | |
5mg | Discontinued | Request information | |
10mg | Discontinued | Request information | |
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information |