CAS 1163123-39-4

2-chloro-4-fluorobenzo[d]oxazole

Description:

2-Chloro-4-fluorobenzo[d]oxazole is a heterocyclic organic compound characterized by the presence of both chlorine and fluorine substituents on a benzo[d]oxazole ring system. This compound features a fused benzene and oxazole ring, which contributes to its aromaticity and stability. The chlorine atom is typically located at the 2-position, while the fluorine is at the 4-position of the benzene ring. These halogen substituents can significantly influence the compound's reactivity, polarity, and potential biological activity. 2-Chloro-4-fluorobenzo[d]oxazole is often utilized in medicinal chemistry and material science due to its unique electronic properties and ability to participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. Its structural characteristics may also allow for interactions with biological targets, making it of interest in drug development. As with many halogenated compounds, it is essential to consider its environmental impact and toxicity when handling or utilizing this substance in research or industrial applications.

Formula: C₇H₃ClFNO

InChI: InChI=1S/C7H3ClFNO/c8-7-10-6-4(9)2-1-3-5(6)11-7/h1-3H

SMILES: c1cc(c2c(c1)oc(Cl)n2)F

Synonyms:

• 2-Chloro-4-fluoro-1,3-benzoxazole
• Benzoxazole, 2-chloro-4-fluoro-
• 2-chloro-4-fluorobenzo[d]oxazole

Benzoxazole, 2-chloro-4-fluoro-

CAS: 1163123-39-4

Formula: C₇H₃ClFNO

Purity: 95%

Molecular weight: 171.5562

Ref: IN-DA000C5V

2-Chloro-4-fluorobenzo[d]oxazole

CAS: 1163123-39-4

2-Chloro-4-fluorobenzo[d]oxazole

Purity: 95%

Molecular weight: 171.56g/mol

Ref: 54-PC100875

2-CHLORO-4-FLUOROBENZO[D]OXAZOLE

CAS: 1163123-39-4

Formula: C₇H₃ClFNO

Purity: 95%

Molecular weight: 171.56

Ref: 10-F304245

2-Chloro-4-fluoro-1,3-benzoxazole

CAS: 1163123-39-4

Versatile small molecule scaffold

Formula: C₇H₃ClFNO

Purity: Min. 95%

Molecular weight: 171.55 g/mol

Ref: 3D-NWB12339