CAS 1163126-82-6

Benzene, (chlorocyclobutylmethyl)-

Description:

Benzene, (chlorocyclobutylmethyl)-, identified by its CAS number 1163126-82-6, is an organic compound that features a benzene ring substituted with a chlorocyclobutylmethyl group. This compound is characterized by its aromatic nature due to the presence of the benzene ring, which contributes to its stability and unique reactivity. The chlorocyclobutylmethyl substituent introduces both aliphatic and halogen functionalities, which can influence the compound's physical and chemical properties, such as solubility, boiling point, and reactivity towards nucleophiles. Typically, compounds of this nature may exhibit moderate volatility and can be involved in various chemical reactions, including substitution and elimination reactions. The presence of chlorine can also impart specific characteristics, such as increased polarity and potential for further reactivity. Safety considerations are essential when handling this compound, as chlorinated organic compounds can pose health risks and environmental concerns. Overall, the unique structure of benzene, (chlorocyclobutylmethyl)- makes it a subject of interest in organic synthesis and materials science.

Formula: C₁₁H₁₃Cl

InChI: InChI=1S/C11H13Cl/c12-11(10-7-4-8-10)9-5-2-1-3-6-9/h1-3,5-6,10-11H,4,7-8H2

InChI key: InChIKey=CSQLUGDCEVEFJA-UHFFFAOYSA-N

SMILES: C(Cl)(C1CCC1)C2=CC=CC=C2

Synonyms:

• [Chloro(cyclobutyl)methyl]benzene
• Benzene, (chlorocyclobutylmethyl)-