CymitQuimica logo

CAS 116324-91-5

:

pyridoxal 3-fluorobenzoyl hydrazone

Description:
Pyridoxal 3-fluorobenzoyl hydrazone is a chemical compound derived from pyridoxal, which is a form of vitamin B6, and a hydrazone functional group. It is characterized by its hydrazone linkage, formed between the carbonyl group of pyridoxal and the hydrazine derivative of 3-fluorobenzoyl. This compound typically exhibits properties such as solubility in organic solvents and potential reactivity due to the presence of both the hydrazone and aromatic fluorobenzene moieties. Pyridoxal derivatives are often studied for their biological activity, including potential roles in enzyme inhibition or as intermediates in various biochemical pathways. The presence of the fluorine atom can influence the compound's electronic properties and biological interactions. As with many hydrazones, it may also exhibit tautomerism, which can affect its stability and reactivity. Overall, pyridoxal 3-fluorobenzoyl hydrazone is of interest in medicinal chemistry and biochemistry for its potential applications in drug development and as a biochemical probe.
Formula:C15H14FN3O3
InChI:InChI=1/C15H14FN3O3/c1-9-14(21)13(11(8-20)6-17-9)7-18-19-15(22)10-3-2-4-12(16)5-10/h2-7,18,20H,8H2,1H3,(H,19,22)/b13-7+
Synonyms:
  • PmFBH
  • Benzoic acid, 3-fluoro-, ((3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl)methylene)hydrazide
  • 3-fluoro-N'-{(E)-[5-(hydroxymethyl)-2-methyl-3-oxopyridin-4(3H)-ylidene]methyl}benzohydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.