CAS 1163250-40-5
:2-(3-Chloropropyl)-2,3-dihydro-5,6-dimethoxy-1H-isoindol-1-one
Description:
2-(3-Chloropropyl)-2,3-dihydro-5,6-dimethoxy-1H-isoindol-1-one is a chemical compound characterized by its isoindole structure, which features a bicyclic system containing both a benzene and a pyrrole-like ring. The presence of the 3-chloropropyl group introduces a halogenated alkyl substituent, which can influence the compound's reactivity and solubility. The dimethoxy groups at the 5 and 6 positions enhance the compound's electron-donating properties, potentially affecting its interaction with biological targets. This compound may exhibit interesting pharmacological activities due to its unique structural features, making it a candidate for further research in medicinal chemistry. Additionally, the presence of chlorine can impart specific properties such as increased lipophilicity or altered metabolic pathways. Overall, the combination of these functional groups suggests potential applications in drug development or as a synthetic intermediate in organic chemistry. However, detailed studies would be necessary to fully elucidate its properties and potential uses.
Formula:C13H16ClNO3
InChI:InChI=1S/C13H16ClNO3/c1-17-11-6-9-8-15(5-3-4-14)13(16)10(9)7-12(11)18-2/h6-7H,3-5,8H2,1-2H3
InChI key:InChIKey=OISZAQVSUYHBKV-UHFFFAOYSA-N
SMILES:O=C1C=2C(CN1CCCCl)=CC(OC)=C(OC)C2
Synonyms:- 1H-Isoindol-1-one, 2-(3-chloropropyl)-2,3-dihydro-5,6-dimethoxy-
- 2-(3-Chloropropyl)-5,6-dimethoxyisoindolin-1-one
- 2-(3-Chloropropyl)-2,3-dihydro-5,6-dimethoxy-1H-isoindol-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(3-Chloropropyl)-5,6-dimethoxyisoindolin-1-one
CAS:Controlled ProductFormula:C13H16ClNO3Color and Shape:NeatMolecular weight:269.724
