CymitQuimica logo

CAS 116332-55-9

:

3-(1,3-Dioxolan-2-yl)-1-(4-fluorophenyl)-1-propanone

Description:
3-(1,3-Dioxolan-2-yl)-1-(4-fluorophenyl)-1-propanone, with the CAS number 116332-55-9, is an organic compound characterized by its unique structural features, including a dioxolane ring and a fluorophenyl group. This compound typically exhibits a molecular structure that includes a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the fluorine atom in the para position of the phenyl ring can enhance the compound's lipophilicity and influence its biological activity, making it of interest in medicinal chemistry. Additionally, the dioxolane moiety may impart stability and solubility characteristics, which are beneficial for various chemical reactions. The compound is likely to be a solid or liquid at room temperature, depending on its specific formulation and purity. Its properties, such as melting point, boiling point, and solubility, would be determined through experimental methods, and it may be utilized in the synthesis of pharmaceuticals or agrochemicals due to its functional groups.
Formula:C12H13FO3
InChI:InChI=1S/C12H13FO3/c13-10-3-1-9(2-4-10)11(14)5-6-12-15-7-8-16-12/h1-4,12H,5-8H2
InChI key:InChIKey=MEOUVTIIMKHILV-UHFFFAOYSA-N
SMILES:C(CCC1OCCO1)(=O)C2=CC=C(F)C=C2
Synonyms:
  • 3-(1,3-Dioxolan-2-yl)-4′-fluoropropiophenone
  • 3-(1,3-Dioxolan-2-yl)-1-(4-fluorophenyl)-1-propanone
  • 1-Propanone, 3-(1,3-dioxolan-2-yl)-1-(4-fluorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.