CAS 116339-45-8

2-(3-(TERT-BUTOXYCARBONYLAMINO)-2-OXOPYRROLIDIN-1-YL)ACETICACID

Description:

2-(3-(tert-Butoxycarbonylamino)-2-oxopyrrolidin-1-yl)acetic acid, with the CAS number 116339-45-8, is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring and an acetic acid moiety. The tert-butoxycarbonyl (Boc) group serves as a protecting group for the amino functionality, enhancing the compound's stability and reactivity in various chemical reactions. This compound is typically used in organic synthesis, particularly in the development of pharmaceuticals and biologically active molecules. Its properties include being a solid at room temperature, with solubility in polar organic solvents. The presence of both an amine and a carboxylic acid functional group suggests that it can participate in a range of chemical reactions, including amide formation and esterification. Additionally, the compound may exhibit biological activity due to its structural features, making it of interest in medicinal chemistry. Overall, its unique characteristics make it a valuable intermediate in synthetic organic chemistry.

Formula: C₁₁H₁₈N₂O₅

InChI: InChI=1/C11H18N2O5/c1-11(2,3)18-10(17)12-7-4-5-13(9(7)16)6-8(14)15/h7H,4-6H2,1-3H3,(H,12,17)(H,14,15)

SMILES: CC(C)(C)OC(=NC1CCN(CC(=O)O)C1=O)O

Synonyms:

• {3-[(tert-Butoxycarbonyl)amino]-2-oxopyrrolidin-1-yl}acetic acid
• 1-Pyrrolidineacetic acid, 3-[[(1,1-dimethylethoxy)carbonyl]amino]-2-oxo-

2-(3-(tert-Butoxycarbonylamino)-2-oxopyrrolidin-1-yl)acetic acid

CAS: 116339-45-8

Formula: C₁₁H₁₈N₂O₅

Purity: 95%

Molecular weight: 258.2710

Ref: IN-DA000C93

2-(3-((Tert-butoxycarbonyl)amino)-2-oxopyrrolidin-1-yl)acetic acid

CAS: 116339-45-8

2-(3-((Tert-butoxycarbonyl)amino)-2-oxopyrrolidin-1-yl)acetic acid

Purity: 95%

Molecular weight: 258.27g/mol

Ref: 54-OR86319

2-[3-(Boc-amino)-2-oxopyrrolidin-1-yl]acetic acid

CAS: 116339-45-8

Formula: C₁₁H₁₈N₂O₅

Purity: 95%

Molecular weight: 258.274

Ref: 10-F093169