CAS 116355-16-9: Imidazo[1,2-a]pyridine-6-carbaldehyde

Description:Imidazo[1,2-a]pyridine-6-carbaldehyde is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. This compound features an aldehyde functional group at the 6-position of the imidazo[1,2-a]pyridine structure, making it reactive and useful in various synthetic applications. It typically appears as a solid or liquid, depending on the specific conditions, and is known for its potential biological activity, which has garnered interest in medicinal chemistry. The presence of both nitrogen atoms in the ring system enhances its ability to participate in coordination chemistry and may influence its solubility and reactivity. Imidazo[1,2-a]pyridine derivatives are often explored for their pharmacological properties, including antimicrobial and anticancer activities. As with many organic compounds, handling should be done with care, considering potential toxicity and reactivity. Overall, Imidazo[1,2-a]pyridine-6-carbaldehyde serves as a valuable building block in organic synthesis and drug development.

Formula:C₈H₆N₂O

InChI:InChI=1/C8H6N2O/c11-6-7-1-2-8-9-3-4-10(8)5-7/h1-6H

Synonyms:
Imidazo[1,2-a]pyridine-6-carboxaldehyde (9CI)

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Imidazo[1,2-a]pyridine-6-carboxaldehyde REF: IN-DA000CALCAS: 116355-16-9	96%	42.00 €~477.00 €	Mon 07 Apr 25
Imidazo[1,2-a]pyridine-6-carboxaldehyde REF: 54-OR111513CAS: 116355-16-9	96%	143.00 €~873.00 €	Mon 14 Apr 25
Imidazo[1,2-a]pyridine-6-carbaldehyde REF: 10-F218355CAS: 116355-16-9	95.0%	To inquire	Thu 17 Apr 25
Imidazo[1,2-a]pyridine-6-carbaldehyde REF: 3D-FI150583CAS: 116355-16-9	Min. 95%	- - -	Discontinued product