CAS 1163707-73-0
:5-Bromo-N-(1,1-dimethylethyl)-2-nitrobenzenamine
Description:
5-Bromo-N-(1,1-dimethylethyl)-2-nitrobenzenamine is an organic compound characterized by its bromine and nitro substituents on a benzene ring, along with a tert-butyl amine group. The presence of the bromine atom introduces a halogen functionality, which can influence the compound's reactivity and solubility. The nitro group, known for its electron-withdrawing properties, can affect the compound's electronic characteristics, making it more electrophilic. The tert-butyl group contributes to steric hindrance, which can impact the compound's interactions with other molecules and its overall reactivity. This compound is likely to be a solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique structure suggests potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Safety and handling precautions should be observed due to the presence of bromine and nitro groups, which can pose health risks. As with any chemical, proper characterization through techniques such as NMR, IR, and mass spectrometry is essential for confirming its identity and purity.
Formula:C10H13BrN2O2
InChI:InChI=1S/C10H13BrN2O2/c1-10(2,3)12-8-6-7(11)4-5-9(8)13(14)15/h4-6,12H,1-3H3
InChI key:InChIKey=FXOQUYKHAQDUDT-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(NC(C)(C)C)C=C(Br)C=C1
Synonyms:- Benzenamine, 5-bromo-N-(1,1-dimethylethyl)-2-nitro-
- (5-Bromo-2-nitro-phenyl)-tert-butyl-amine
- 5-Bromo-N-(1,1-dimethylethyl)-2-nitrobenzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
