
CAS 116371-69-8
:2-[(Tributylstannyl)oxy]-2,4,6-cycloheptatrien-1-one
Description:
2-[(Tributylstannyl)oxy]-2,4,6-cycloheptatrien-1-one is an organotin compound characterized by the presence of a tributylstannyl group attached to a cycloheptatriene derivative. This compound features a unique structure that includes a cycloheptatriene ring, which is a seven-membered carbon ring with alternating double bonds, contributing to its potential reactivity and stability. The tributylstannyl group enhances its solubility in organic solvents and can influence its chemical behavior, particularly in reactions involving nucleophiles or electrophiles. Organotin compounds are known for their applications in various fields, including catalysis and materials science, due to their ability to stabilize reactive intermediates. The presence of the oxygen atom in the structure indicates potential for further reactivity, possibly participating in coordination or bonding with other chemical species. Overall, this compound's unique structural features and functional groups suggest it may have specialized applications in organic synthesis or as a precursor in the development of more complex chemical entities.
Formula:C19H32O2Sn
InChI:InChI=1S/C7H6O2.3C4H9.Sn/c8-6-4-2-1-3-5-7(6)9;3*1-3-4-2;/h1-5H,(H,8,9);3*1,3-4H2,2H3;/q;;;;+1/p-1
InChI key:InChIKey=PGWGSFWVTVBEJD-UHFFFAOYSA-M
SMILES:[Sn](OC=1C(=O)C=CC=CC1)(CCCC)(CCCC)CCCC
Synonyms:- 2-[(Tributylstannyl)oxy]-2,4,6-cycloheptatrien-1-one
- 2,4,6-Cycloheptatrien-1-one, 2-[(tributylstannyl)oxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,4,6-Cycloheptatrien-1-one, 2-[(tributylstannyl)oxy]-
CAS:Formula:C19H32O2SnMolecular weight:411.1572
