CAS 116373-23-0
:N-benzyl-1-cyclopropylmethanamine
Description:
N-benzyl-1-cyclopropylmethanamine is an organic compound characterized by its unique structure, which includes a cyclopropyl group and a benzyl moiety attached to a methanamine backbone. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the cyclopropyl ring may impart distinctive steric and electronic effects, potentially affecting its reactivity and interaction with biological targets. N-benzyl-1-cyclopropylmethanamine may also display pharmacological activity, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in the design of compounds targeting specific receptors or enzymes. As with many amines, it may have a characteristic amine odor and can participate in various chemical reactions, including alkylation and acylation. Safety and handling considerations are essential, as with all chemical substances, to mitigate any risks associated with its use in laboratory or industrial settings.
Formula:C11H15N
InChI:InChI=1/C11H15N/c1-2-4-10(5-3-1)8-12-9-11-6-7-11/h1-5,11-12H,6-9H2
SMILES:c1ccc(cc1)CNCC1CC1
Synonyms:- benzenemethanamine, N-(cyclopropylmethyl)-
- N-Benzylcyclopropylmethylamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
N-Benzyl(cyclopropyl)methanamine
CAS:<p>N-Benzyl(cyclopropyl)methanamine is a phenanthrene derivative that is synthesized by the reaction of benzylic methylene with methanol. This compound can be hydrolyzed to benzoic acid and cyclopropanol. N-Benzyl(cyclopropyl)methanamine has been used as an electrode material for organic electrochemical cells as it has high electron transfer and overpotential, making this compound more suitable than other materials such as benzylic or alkyl groups. The synthesis of esters from N-benzyl(cyclopropyl)methanamine can be achieved through the use of acetals.</p>Formula:C11H15NPurity:Min. 95%Molecular weight:161.24 g/mol


