CymitQuimica logo

CAS 116401-54-8

:

1H-Imidazole-4-carboxylic acid, 5-amino-, methyl ester, hydrochloride (1:1)

Description:
1H-Imidazole-4-carboxylic acid, 5-amino-, methyl ester, hydrochloride (1:1) is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a carboxylic acid group and an amino group, contributing to its potential as a biological and pharmaceutical agent. The methyl ester form indicates that the carboxylic acid is esterified with methanol, enhancing its solubility and reactivity. The hydrochloride salt form suggests that the compound is protonated, which can improve its stability and solubility in aqueous solutions. This compound may exhibit properties such as being a weak base due to the presence of the imidazole nitrogen, and it could participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Its biological relevance may include roles in enzyme catalysis or as a building block in the synthesis of more complex molecules. Overall, this compound's unique structure and functional groups make it of interest in medicinal chemistry and biochemistry.
Formula:C5H7N3O2·ClH
InChI:InChI=1S/C5H7N3O2.ClH/c1-10-5(9)3-4(6)8-2-7-3;/h2H,6H2,1H3,(H,7,8);1H
InChI key:InChIKey=UKCFJLABBRWGEP-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(N)N=CN1.Cl
Synonyms:
  • 1H-Imidazole-4-carboxylic acid, 5-amino-, methyl ester, monohydrochloride
  • Methyl 4-amino-1H-imidazole-5-carboxylate hydrochloride
  • 1H-Imidazole-4-carboxylic acid, 5-amino-, methyl ester, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.