CAS 116406-21-4

Methyl (2E)-3-(2,3,4-trimethoxyphenyl)-2-propenoate

Description:

Methyl (2E)-3-(2,3,4-trimethoxyphenyl)-2-propenoate, with the CAS number 116406-21-4, is an organic compound characterized by its ester functional group and a conjugated double bond system. This compound features a methyl ester derived from a substituted cinnamic acid, specifically incorporating a 2,3,4-trimethoxyphenyl group, which contributes to its aromatic properties and potential biological activity. The presence of multiple methoxy groups enhances its lipophilicity and may influence its reactivity and solubility in organic solvents. The geometric configuration indicated by the (2E) notation suggests that the double bond is in the trans configuration, which can affect the compound's stability and interactions with other molecules. Methyl (2E)-3-(2,3,4-trimethoxyphenyl)-2-propenoate may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and natural product research. Its synthesis and characterization would typically involve standard organic reactions, including esterification and possibly further functionalization to explore its potential applications.

Formula: C₁₃H₁₆O₅

InChI: InChI=1S/C13H16O5/c1-15-10-7-5-9(6-8-11(14)16-2)12(17-3)13(10)18-4/h5-8H,1-4H3/b8-6+

InChI key: InChIKey=BDPRQDJNPJRLOB-SOFGYWHQSA-N

SMILES: O(C)C1=C(OC)C(OC)=CC=C1/C=C/C(OC)=O

Synonyms:

• 2-Propenoic acid, 3-(2,3,4-trimethoxyphenyl)-, methyl ester, (2E)-
• Methyl (2E)-3-(2,3,4-trimethoxyphenyl)-2-propenoate
• 2-Propenoic acid, 3-(2,3,4-trimethoxyphenyl)-, methyl ester, (E)-

Methyl (2e)-3-(2,3,4-trimethoxyphenyl)acrylate

CAS: 116406-21-4

Formula: C₁₃H₁₆O₅

Molecular weight: 252.2631

Ref: IN-DA000CE5

Methyl (2E)-3-(2,3,4-trimethoxyphenyl)acrylate

CAS: 116406-21-4

Methyl (2E)-3-(2,3,4-trimethoxyphenyl)acrylate is a chemical reagent that can be used as a building block for complex compounds. It is a versatile and useful intermediate for the synthesis of more complex compounds. Methyl (2E)-3-(2,3,4-trimethoxyphenyl)acrylate is also a high quality chemical with a speciality use in research. The CAS number for this compound is 116406-21-4.

Formula: C₁₃H₁₆O₅

Purity: Min. 95%

Molecular weight: 252.26 g/mol

Ref: 3D-REA40621