
CAS 116409-32-6
:8-Methyl-1-isoquinolinecarboxaldehyde
Description:
8-Methyl-1-isoquinolinecarboxaldehyde is an organic compound characterized by its isoquinoline structure, which features a fused bicyclic system containing a nitrogen atom. This compound has a methyl group at the 8-position and an aldehyde functional group at the 1-position, contributing to its reactivity and potential applications in organic synthesis. It is typically a yellow to brown solid at room temperature and is soluble in organic solvents such as ethanol and dichloromethane. The presence of the aldehyde group makes it a versatile intermediate in the synthesis of various pharmaceuticals and agrochemicals. Additionally, its isoquinoline framework is of interest in medicinal chemistry due to its biological activity, including potential antitumor and antimicrobial properties. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use. Overall, 8-Methyl-1-isoquinolinecarboxaldehyde is a valuable compound in chemical research and development.
Formula:C11H9NO
InChI:InChI=1S/C11H9NO/c1-8-3-2-4-9-5-6-12-10(7-13)11(8)9/h2-7H,1H3
InChI key:InChIKey=BLUYTULJMWFORV-UHFFFAOYSA-N
SMILES:C(=O)C=1C2=C(C=CN1)C=CC=C2C
Synonyms:- 8-Methyl-1-isoquinolinecarboxaldehyde
- 1-Isoquinolinecarboxaldehyde, 8-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.