CymitQuimica logo

CAS 1164100-83-7

:

B-[5-(Aminocarbonyl)-2-pyridinyl]boronic acid

Description:
B-[5-(Aminocarbonyl)-2-pyridinyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group and a pyridine ring substituted with an aminocarbonyl group. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar solvents like water and methanol, and possessing a moderate melting point. The boronic acid moiety allows for the formation of reversible covalent bonds with diols, making it useful in various applications, including medicinal chemistry and organic synthesis. Its structure suggests potential biological activity, particularly in the context of drug development, where it may act as a protease inhibitor or in targeting specific biomolecules. Additionally, the presence of the aminocarbonyl group can enhance its reactivity and solubility, contributing to its utility in chemical reactions and biological systems. Overall, B-[5-(Aminocarbonyl)-2-pyridinyl]boronic acid is a versatile compound with significant implications in both research and pharmaceutical applications.
Formula:C6H7BN2O3
InChI:InChI=1S/C6H7BN2O3/c8-6(10)4-1-2-5(7(11)12)9-3-4/h1-3,11-12H,(H2,8,10)
InChI key:InChIKey=AGBSBEROHUIBPQ-UHFFFAOYSA-N
SMILES:C(N)(=O)C=1C=CC(B(O)O)=NC1
Synonyms:
  • (5-Carbamoylpyridin-2-yl)boronic acid
  • Boronic acid, B-[5-(aminocarbonyl)-2-pyridinyl]-
  • 5-(Aminocarbonyl)pyridin-2-ylboronic acid
  • B-[5-(Aminocarbonyl)-2-pyridinyl]boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.