CAS 116412-97-6
:(3,5-dichlorophenyl)-(3,4-dimethoxyphenyl)methanone
Description:
(3,5-Dichlorophenyl)-(3,4-dimethoxyphenyl)methanone, with the CAS number 116412-97-6, is an organic compound characterized by its complex aromatic structure. It features a ketone functional group, indicated by the "methanone" part of its name, which is attached to a phenyl ring that is further substituted with chlorine and methoxy groups. The presence of the dichloro substituents on one phenyl ring enhances its reactivity and may influence its biological activity, while the dimethoxy groups on the other ring can affect its solubility and electronic properties. This compound is likely to exhibit interesting chemical behavior due to the interplay of its substituents, making it a subject of interest in fields such as medicinal chemistry and materials science. Its synthesis and potential applications could be explored in the context of drug development or as a precursor in organic synthesis. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C15H12Cl2O3
InChI:InChI=1/C15H12Cl2O3/c1-19-13-4-3-9(7-14(13)20-2)15(18)10-5-11(16)8-12(17)6-10/h3-8H,1-2H3
SMILES:COc1ccc(cc1OC)C(=O)c1cc(cc(c1)Cl)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
