CymitQuimica logo

CAS 116413-00-4

:

(3,4-dimethoxyphenyl)(4-iodophenyl)methanone

Description:
(3,4-Dimethoxyphenyl)(4-iodophenyl)methanone, with the CAS number 116413-00-4, is an organic compound characterized by its complex structure, which includes a ketone functional group and two aromatic rings. The presence of methoxy groups on one of the phenyl rings enhances its electron-donating properties, potentially influencing its reactivity and solubility in various solvents. The iodine substituent on the other phenyl ring introduces significant steric and electronic effects, which can affect the compound's stability and reactivity. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for further research in medicinal chemistry. Additionally, its synthesis typically involves reactions such as Friedel-Crafts acylation or coupling reactions, which are common in organic synthesis. The compound's physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. Overall, (3,4-dimethoxyphenyl)(4-iodophenyl)methanone represents a versatile building block in organic synthesis and pharmaceutical development.
Formula:C15H13IO3
InChI:InChI=1/C15H13IO3/c1-18-13-8-5-11(9-14(13)19-2)15(17)10-3-6-12(16)7-4-10/h3-9H,1-2H3
SMILES:COc1ccc(cc1OC)C(=O)c1ccc(cc1)I
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.