CAS 116419-36-4

(3-nitro-1H-1,2,4-triazol-1-yl)acetic acid

Description:

(3-nitro-1H-1,2,4-triazol-1-yl)acetic acid is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a nitro group (-NO2) at the 3-position of the triazole ring, contributing to its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The acetic acid moiety provides acidic properties, allowing it to participate in various chemical reactions, such as esterification or amidation. The presence of both the triazole and the carboxylic acid functional groups suggests that this compound may exhibit interesting biological activities, potentially acting as a ligand or a precursor in synthetic pathways. Its solubility and stability can vary depending on the solvent and environmental conditions, making it important to consider these factors in practical applications. Overall, (3-nitro-1H-1,2,4-triazol-1-yl)acetic acid is a versatile compound with significant implications in chemical research and development.

Formula: C₄H₄N₄O₄

InChI: InChI=1/C4H4N4O4/c9-3(10)1-7-2-5-4(6-7)8(11)12/h2H,1H2,(H,9,10)

SMILES: C(C(=O)O)n1cnc(n1)N(=O)=O

Synonyms:

• 1H-1,2,4-Triazole-1-acetic acid, 3-nitro-

(3-Nitro-1h-1,2,4-triazol-1-yl)acetic acid

CAS: 116419-36-4

Formula: C₄H₄N₄O₄

Molecular weight: 172.0990

Ref: IN-DA000CFH

(3-Nitro-[1,2,4]triazol-1-yl)-acetic acid

CAS: 116419-36-4

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 172.10000610351562

Ref: 10-F027896