CAS 116422-39-0

(S)-(+)-2-METHOXYPROPANOL

Description:

(S)-(+)-2-Methoxypropanol, with the CAS number 116422-39-0, is an organic compound characterized by its chiral nature, featuring a methoxy group (-OCH3) attached to a propanol backbone. This compound is a colorless liquid with a mild odor and is known for its solubility in water and various organic solvents, making it versatile in chemical applications. It exhibits properties typical of alcohols, including the ability to participate in hydrogen bonding, which contributes to its relatively high boiling point compared to hydrocarbons of similar molecular weight. The presence of the methoxy group enhances its reactivity, allowing it to engage in various chemical reactions, such as ether formation and nucleophilic substitutions. Additionally, (S)-(+)-2-Methoxypropanol is often utilized as a solvent in organic synthesis and as an intermediate in the production of other chemical compounds. Its chirality may impart specific biological activities, making it of interest in pharmaceutical applications. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.

Formula: C₄H₁₀O₂

InChI: InChI=1/C4H10O2/c1-4(3-5)6-2/h4-5H,3H2,1-2H3/t4-/m0/s1

SMILES: C[C@@H](CO)OC

Synonyms:

• (2S)-2-methoxypropan-1-ol

1-Propanol, 2-methoxy-, (2S)-

CAS: 116422-39-0

Formula: C₄H₁₀O₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 90.1210

Ref: IN-DA000CGJ

(S)-(+)-2-Methoxypropanol

CAS: 116422-39-0

(S)-(+)-2-Methoxypropanol

Purity: 99%

Molecular weight: 90.12g/mol

Ref: 54-OR1025430

(2S)-2-Methoxy-1-propanol

CAS: 116422-39-0

Formula: C₄H₁₀O₂

Color and Shape: Neat

Molecular weight: 90.121

Ref: TR-M219653

(2S)-2-methoxy-1-propanol

CAS: 116422-39-0

Formula: C₄H₁₀O₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 90.122

Ref: 10-F385675