CAS 116435-83-7

Ethyl 2-hydroxy-5-nitrobenzeneacetate

Description:

Ethyl 2-hydroxy-5-nitrobenzeneacetate, with the CAS number 116435-83-7, is an organic compound characterized by its ester functional group and the presence of both a hydroxyl (-OH) and a nitro (-NO2) group on the aromatic ring. This compound typically appears as a yellow to light brown solid or liquid, depending on its purity and specific conditions. It is soluble in organic solvents, such as ethanol and acetone, but may have limited solubility in water due to its hydrophobic aromatic structure. The presence of the nitro group contributes to its potential reactivity and may influence its biological activity, making it of interest in various chemical and pharmaceutical applications. Ethyl 2-hydroxy-5-nitrobenzeneacetate can be synthesized through specific chemical reactions involving the appropriate starting materials, and it may be utilized in research settings for its potential as an intermediate in the synthesis of other compounds or for studying its properties in medicinal chemistry. Safety precautions should be observed when handling this compound, as with many nitro-substituted aromatic compounds.

Formula: C₁₀H₁₁NO₅

InChI: InChI=1S/C10H11NO5/c1-2-16-10(13)6-7-5-8(11(14)15)3-4-9(7)12/h3-5,12H,2,6H2,1H3

InChI key: InChIKey=ZGUZUTUKPABYCQ-UHFFFAOYSA-N

SMILES: C(C(OCC)=O)C1=CC(N(=O)=O)=CC=C1O

Synonyms:

• (2-Hydroxy-5-nitro-phenyl)-acetic acid ethyl ester
• Ethyl 2-hydroxy-5-nitrobenzeneacetate
• Benzeneacetic acid, 2-hydroxy-5-nitro-, ethyl ester