CAS 116436-11-4
:N-(2-Bromo-6-methylphenyl)acetamide
Description:
N-(2-Bromo-6-methylphenyl)acetamide is an organic compound characterized by its amide functional group, which is derived from acetic acid and an aromatic amine. The presence of a bromine atom at the 2-position and a methyl group at the 6-position on the phenyl ring contributes to its unique chemical properties. This compound typically appears as a solid at room temperature and is soluble in organic solvents. Its molecular structure suggests potential reactivity in nucleophilic substitution reactions due to the electrophilic nature of the carbonyl carbon in the amide group. Additionally, the bromine substituent can participate in further chemical transformations, such as cross-coupling reactions. N-(2-Bromo-6-methylphenyl)acetamide may exhibit biological activity, making it of interest in pharmaceutical research. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, this compound serves as a valuable building block in organic synthesis and medicinal chemistry.
Formula:C9H10BrNO
InChI:InChI=1S/C9H10BrNO/c1-6-4-3-5-8(10)9(6)11-7(2)12/h3-5H,1-2H3,(H,11,12)
InChI key:InChIKey=VXIIBTQSQWEMHV-UHFFFAOYSA-N
SMILES:N(C(C)=O)C1=C(Br)C=CC=C1C
Synonyms:- N-(2-Bromo-6-methylphenyl)acetamide
- Acetamide, N-(2-bromo-6-methylphenyl)-
- 2-Bromo-6-methylacetanilide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
