CAS 116447-43-9

2-Pentenedioic acid, 2-[[(phenylmethoxy)carbonyl]amino]-, (Z)-

Description:

2-Pentenedioic acid, 2-[[(phenylmethoxy)carbonyl]amino]-, (Z)-, also known by its CAS number 116447-43-9, is an organic compound characterized by its unique structure that includes a pentenedioic acid backbone with an amino group substituted by a phenylmethoxycarbonyl moiety. This compound features a double bond in the pentenedioic acid portion, which contributes to its reactivity and potential for undergoing various chemical transformations. The (Z)- configuration indicates that the substituents around the double bond are on the same side, influencing its stereochemistry and potentially its biological activity. The presence of the phenylmethoxy group enhances its lipophilicity, which may affect its solubility and interaction with biological systems. This compound may be of interest in synthetic organic chemistry and medicinal chemistry due to its potential applications in drug development and as an intermediate in the synthesis of more complex molecules. Its properties, such as melting point, boiling point, and solubility, would be determined by its specific molecular interactions and functional groups.

Formula: C₁₃H₁₃NO₆

InChI: InChI=1S/C13H13NO6/c15-11(16)7-6-10(12(17)18)14-13(19)20-8-9-4-2-1-3-5-9/h1-6H,7-8H2,(H,14,19)(H,15,16)(H,17,18)/b10-6-

InChI key: InChIKey=ZDEKDZYJZIJMMR-POHAHGRESA-N

SMILES: C(OC(N/C(=C\CC(O)=O)/C(O)=O)=O)C1=CC=CC=C1

Synonyms:

• 2-Pentenedioic acid, 2-[[(phenylmethoxy)carbonyl]amino]-, (Z)-

2-Pentenedioic acid, 2-[[(phenylmethoxy)carbonyl]amino]-, (Z)- (9CI)

CAS: 116447-43-9

Formula: C₁₃H₁₃NO₆

Molecular weight: 279.2454

Ref: IN-DA000CIL